Products 1314701-10-4
CAS 1314701-10-4 is the registry number for 2-(1-Cyanocyclopropyl)benzoic acid, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(1-cyanocyclopropyl)benzoic acid (CAS 1314701-10-4) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-(1-cyanocyclopropyl)benzoic acid. InChIKey: UHRBZFKYKDWNPY-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-(1-cyanocyclopropyl)benzoic acid |
| InChIKey | UHRBZFKYKDWNPY-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)