Products 1314701-46-6
CAS 1314701-46-6 is the registry number for Gliquidone Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-carboxypropan-2-yl)-5-methoxybenzoic acid (CAS 1314701-46-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(2-carboxypropan-2-yl)-5-methoxybenzoic acid. InChIKey: PQWWGPAYRLPNLQ-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(2-carboxypropan-2-yl)-5-methoxybenzoic acid |
| InChIKey | PQWWGPAYRLPNLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)OC)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)