CAS 1314709-48-2 appears in our catalog under these names: 1–(3–fluoro–4–methoxyphenyl)cyclobutane–1–carboxylic acid, 1-(3-fluoro-4-methoxyphenyl)cyclobutane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
1-(3-fluoro-4-methoxyphenyl)cyclobutane-1-carboxylic acid (CAS 1314709-48-2) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: 1-(3-fluoro-4-methoxyphenyl)cyclobutane-1-carboxylic acid. InChIKey: QDFBYWOJVBKNKI-UHFFFAOYSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 1-(3-fluoro-4-methoxyphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | QDFBYWOJVBKNKI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CCC2)C(=O)O)F |
Computed by PubChem (NCBI)