CAS 131484-83-8 is the registry number for (R)-Indobufen. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid (CAS 131484-83-8) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: (2R)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid. InChIKey: AYDXAULLCROVIT-OAHLLOKOSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | (2R)-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]butanoic acid |
| InChIKey | AYDXAULLCROVIT-OAHLLOKOSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O |
Computed by PubChem (NCBI)