CAS 146803-41-0 appears in our catalog under these names: Fmoc-ala-aldehyde, 95%, Fmoc–Ala–aldehyde, Fmoc-L-Ala-aldehyde 97%, FMOC-ALA-ALDEHYDE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg.
9H-fluoren-9-ylmethyl N-[(2S)-1-oxopropan-2-yl]carbamate (CAS 146803-41-0) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S)-1-oxopropan-2-yl]carbamate. InChIKey: LJGFXAKKZLFEDR-LBPRGKRZSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S)-1-oxopropan-2-yl]carbamate |
| InChIKey | LJGFXAKKZLFEDR-LBPRGKRZSA-N |
| SMILES | C[C@@H](C=O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)