CAS 4950-65-6 is the registry number for Trans-cinnamoyl-phe-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid (CAS 4950-65-6) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: (2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid. InChIKey: YFHVCODMDZNZEA-PCUGXKRQSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid |
| InChIKey | YFHVCODMDZNZEA-PCUGXKRQSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)