CAS 1243022-77-6 is the registry number for 4-(1-Propionyl-2,3-dihydro-1h-indol-5-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoic acid (CAS 1243022-77-6) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoic acid. InChIKey: MYCCKZVMSXRHKM-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoic acid |
| InChIKey | MYCCKZVMSXRHKM-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1CCC2=C1C=CC(=C2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)