Products 1243022-77-6

CAS 1243022-77-6 is the registry number for 4-(1-Propionyl-2,3-dihydro-1h-indol-5-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoic acid (CAS 1243022-77-6) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoic acid. InChIKey: MYCCKZVMSXRHKM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO3
Molecular weight295.3 g/mol
IUPAC name4-(1-propanoyl-2,3-dihydroindol-5-yl)benzoic acid
InChIKeyMYCCKZVMSXRHKM-UHFFFAOYSA-N
SMILESCCC(=O)N1CCC2=C1C=CC(=C2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)