Products 1315347-10-4
CAS 1315347-10-4 is the registry number for 2-(5-Chloro-1H-1,2,4-triazol-3-yl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-chloro-1H-1,2,4-triazol-3-yl)pyridine (CAS 1315347-10-4) is a chemical compound with the molecular formula C7H5ClN4 and a molecular weight of 180.59 g/mol. IUPAC name: 2-(5-chloro-1H-1,2,4-triazol-3-yl)pyridine. InChIKey: LIJKCWDRRSUZMP-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 2-(5-chloro-1H-1,2,4-triazol-3-yl)pyridine |
| InChIKey | LIJKCWDRRSUZMP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NNC(=N2)Cl |
Computed by PubChem (NCBI)