CAS 1315367-39-5 appears in our catalog under these names: 6-Chloro-8-methyl-1,2,3,4-tetrahydroquinoline hydrochloride, 95%, 6-Chloro-8-methyl-1,2,3,4-tetrahydroquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
6-chloro-8-methyl-1,2,3,4-tetrahydroquinoline;hydrochloride (CAS 1315367-39-5) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 6-chloro-8-methyl-1,2,3,4-tetrahydroquinoline;hydrochloride. InChIKey: CAFJIVNYEONGSY-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 6-chloro-8-methyl-1,2,3,4-tetrahydroquinoline;hydrochloride |
| InChIKey | CAFJIVNYEONGSY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NCCC2)Cl.Cl |
Computed by PubChem (NCBI)