Products 1315368-34-3
CAS 1315368-34-3 is the registry number for (2-Aminobenzo[d]oxazol-6-yl)(morpholino)methanone, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-amino-1,3-benzoxazol-6-yl)-morpholin-4-ylmethanone (CAS 1315368-34-3) is a chemical compound with the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. IUPAC name: (2-amino-1,3-benzoxazol-6-yl)-morpholin-4-ylmethanone. InChIKey: YYGZVPWBWUDERZ-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O3 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2-amino-1,3-benzoxazol-6-yl)-morpholin-4-ylmethanone |
| InChIKey | YYGZVPWBWUDERZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC3=C(C=C2)N=C(O3)N |
Computed by PubChem (NCBI)