CAS 1315501-18-8 appears in our catalog under these names: Cypermethrin Impurity 9, zeta-Cypermethrin, >95% (HPLC), zeta-Cypermethrin, zeta-Cypermethrin 10 µg/mL in Cyclohexane, zeta-Cypermethrin, Concentration: 100 µg/ml Solvent: Acetone. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 10ml, 1x5ml, 1x100mg.
[(S)-cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 1315501-18-8) is a chemical compound with the molecular formula C22H19Cl2NO3 and a molecular weight of 416.3 g/mol. IUPAC name: [(S)-cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: KAATUXNTWXVJKI-QPIRBTGLSA-N.
| Molecular formula | C22H19Cl2NO3 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | [(S)-cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | KAATUXNTWXVJKI-QPIRBTGLSA-N |
| SMILES | CC1(C(C1C(=O)O[C@H](C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)