CAS 1315552-05-6 appears in our catalog under these names: Loline Impurity 2, (1R,2R,7R,7aS)-1-Azido-7-chlorohexahydro-1H-pyrrolizin-2-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(1R,2R,7R,8S)-1-azido-7-chloro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol (CAS 1315552-05-6) is a chemical compound with the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. IUPAC name: (1R,2R,7R,8S)-1-azido-7-chloro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol. InChIKey: MPRUEENYZUXHRP-MVIOUDGNSA-N.
| Molecular formula | C7H11ClN4O |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1R,2R,7R,8S)-1-azido-7-chloro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol |
| InChIKey | MPRUEENYZUXHRP-MVIOUDGNSA-N |
| SMILES | C1CN2C[C@H]([C@@H]([C@H]2[C@@H]1Cl)N=[N+]=[N-])O |
Computed by PubChem (NCBI)