CAS 2126161-38-2 appears in our catalog under these names: 1-(1-(Azetidin-3-yl)-1H-1,2,3-triazol-4-yl)ethan-1-one hydrochloride, 95%, 1-(1-(Azetidin-3-yl)-1H-1,2,3-triazol-4-yl)ethan-1-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[1-(azetidin-3-yl)triazol-4-yl]ethanone;hydrochloride (CAS 2126161-38-2) is a chemical compound with the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. IUPAC name: 1-[1-(azetidin-3-yl)triazol-4-yl]ethanone;hydrochloride. InChIKey: SZLZNDFFJWZART-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN4O |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 1-[1-(azetidin-3-yl)triazol-4-yl]ethanone;hydrochloride |
| InChIKey | SZLZNDFFJWZART-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(N=N1)C2CNC2.Cl |
Computed by PubChem (NCBI)