Products 1269534-81-7
CAS 1269534-81-7 is the registry number for 4-Chloro-5-hydrazinyl-2-isopropylpyridazin-3(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-hydrazinyl-2-propan-2-ylpyridazin-3-one (CAS 1269534-81-7) is a chemical compound with the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. IUPAC name: 4-chloro-5-hydrazinyl-2-propan-2-ylpyridazin-3-one. InChIKey: MXABNUOIAPWKCF-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN4O |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 4-chloro-5-hydrazinyl-2-propan-2-ylpyridazin-3-one |
| InChIKey | MXABNUOIAPWKCF-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C(=C(C=N1)NN)Cl |
Computed by PubChem (NCBI)