CAS 1430327-79-9 is the registry number for 6,7,8,8A-Tetrahydro-4h,5ah-pyrrolo[3,4-b][1,2,3]triazolo[1,5-d][1,4]oxazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride (CAS 1430327-79-9) is a chemical compound with the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. IUPAC name: 7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride. InChIKey: YWBKKQRXJQMKJK-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN4O |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride |
| InChIKey | YWBKKQRXJQMKJK-UHFFFAOYSA-N |
| SMILES | C1C2C(CN1)OCC3=CN=NN23.Cl |
Computed by PubChem (NCBI)