CAS 13161-99-4 appears in our catalog under these names: (2Z,2'Z)-4,4'-(1,3-Phenylenebis(azanediyl))bis(4-oxobut-2-enoic acid), 95%, (2Z,2'Z)-4,4'-(1,3-Phenylenediimino)bis[4-oxo-2-butenoic acid], 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(Z)-4-[3-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-4-oxobut-2-enoic acid (CAS 13161-99-4) is a chemical compound with the molecular formula C14H12N2O6 and a molecular weight of 304.25 g/mol. IUPAC name: (Z)-4-[3-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-4-oxobut-2-enoic acid. InChIKey: SKDIMRRKRVTENP-PEPZGXQESA-N.
| Molecular formula | C14H12N2O6 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | (Z)-4-[3-[[(Z)-3-carboxyprop-2-enoyl]amino]anilino]-4-oxobut-2-enoic acid |
| InChIKey | SKDIMRRKRVTENP-PEPZGXQESA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)/C=C\C(=O)O)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)