CAS 2499-70-9 is the registry number for 2,2'-Dimethoxy-4,4'-dinitro-1,1'-biphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-1-(2-methoxy-4-nitrophenyl)-4-nitrobenzene (CAS 2499-70-9) is a chemical compound with the molecular formula C14H12N2O6 and a molecular weight of 304.25 g/mol. IUPAC name: 2-methoxy-1-(2-methoxy-4-nitrophenyl)-4-nitrobenzene. InChIKey: JXAGVLKYILKGMN-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O6 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | 2-methoxy-1-(2-methoxy-4-nitrophenyl)-4-nitrobenzene |
| InChIKey | JXAGVLKYILKGMN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])C2=C(C=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)