CAS 885273-59-6 is the registry number for Ethyl 3-(2-carboxy-vinyl)-5-nitro-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-(2-ethoxycarbonyl-5-nitro-1H-indol-3-yl)prop-2-enoic acid (CAS 885273-59-6) is a chemical compound with the molecular formula C14H12N2O6 and a molecular weight of 304.25 g/mol. IUPAC name: (E)-3-(2-ethoxycarbonyl-5-nitro-1H-indol-3-yl)prop-2-enoic acid. InChIKey: DAKYHZYBCBZETG-GQCTYLIASA-N.
| Molecular formula | C14H12N2O6 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | (E)-3-(2-ethoxycarbonyl-5-nitro-1H-indol-3-yl)prop-2-enoic acid |
| InChIKey | DAKYHZYBCBZETG-GQCTYLIASA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=CC(=C2)[N+](=O)[O-])/C=C/C(=O)O |
Computed by PubChem (NCBI)