CAS 14467-69-7 appears in our catalog under these names: 1,2-Bis(4-nitrophenoxy)ethane, 95%, 95%, 1,1'-[ethane-1,2-diylbis(oxy)]bis(4-nitrobenzene), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-nitro-4-[2-(4-nitrophenoxy)ethoxy]benzene (CAS 14467-69-7) is a chemical compound with the molecular formula C14H12N2O6 and a molecular weight of 304.25 g/mol. IUPAC name: 1-nitro-4-[2-(4-nitrophenoxy)ethoxy]benzene. InChIKey: DGNVEKKAEPFSIH-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O6 |
|---|---|
| Molecular weight | 304.25 g/mol |
| IUPAC name | 1-nitro-4-[2-(4-nitrophenoxy)ethoxy]benzene |
| InChIKey | DGNVEKKAEPFSIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCCOC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)