Products 1316216-06-4

CAS 1316216-06-4 is the registry number for 2-(Diphenylamino)pyrimidine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(N-phenylanilino)pyrimidine-5-carboxylic acid (CAS 1316216-06-4) is a chemical compound with the molecular formula C17H13N3O2 and a molecular weight of 291.30 g/mol. IUPAC name: 2-(N-phenylanilino)pyrimidine-5-carboxylic acid. InChIKey: MMYPIVCZGPMEMY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13N3O2
Molecular weight291.30 g/mol
IUPAC name2-(N-phenylanilino)pyrimidine-5-carboxylic acid
InChIKeyMMYPIVCZGPMEMY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=NC=C(C=N3)C(=O)O

Computed by PubChem (NCBI)