CAS 1429618-03-0 appears in our catalog under these names: 4-Ethyl-3-(2-(pyrazolo[1,5-a]pyrimidin-6-yl)ethynyl)benzoic acid, 95%, 4-ethyl-3-(2-{pyrazolo(1,5-a)pyrimidin-6-yl}ethynyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
4-ethyl-3-(2-pyrazolo[1,5-a]pyrimidin-6-ylethynyl)benzoic acid (CAS 1429618-03-0) is a chemical compound with the molecular formula C17H13N3O2 and a molecular weight of 291.30 g/mol. IUPAC name: 4-ethyl-3-(2-pyrazolo[1,5-a]pyrimidin-6-ylethynyl)benzoic acid. InChIKey: RPTLNQGKEBHGPL-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 4-ethyl-3-(2-pyrazolo[1,5-a]pyrimidin-6-ylethynyl)benzoic acid |
| InChIKey | RPTLNQGKEBHGPL-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(=O)O)C#CC2=CN3C(=CC=N3)N=C2 |
Computed by PubChem (NCBI)