CAS 62570-50-7 appears in our catalog under these names: Disperse Blue 359 (Technical Grade), Disperse Blue 359, Disperse Blue 359, 1-Amino-4-(ethylamino)-9,10-dioxo-9,10-dihydroanthracene-2-carbonitrile. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 100g, 25g, 500g, 5g, 100 mg.
1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-carbonitrile (CAS 62570-50-7) is a chemical compound with the molecular formula C17H13N3O2 and a molecular weight of 291.30 g/mol. IUPAC name: 1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-carbonitrile. InChIKey: ATXPWKWYLDEURI-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-carbonitrile |
| InChIKey | ATXPWKWYLDEURI-UHFFFAOYSA-N |
| SMILES | CCNC1=C2C(=C(C(=C1)C#N)N)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)