CAS 1356385-96-0 is the registry number for Methyl 3-(imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoate (CAS 1356385-96-0) is a chemical compound with the molecular formula C17H13N3O2 and a molecular weight of 291.30 g/mol. IUPAC name: methyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoate. InChIKey: WIKRCQCIGCKHMQ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | methyl 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoate |
| InChIKey | WIKRCQCIGCKHMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)C#CC2=CN=C3N2N=CC=C3 |
Computed by PubChem (NCBI)