CAS 131669-07-3 is the registry number for (S)–2–(((Benzyloxy)carbonyl)amino)–3–(4–cyanophenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(2S)-3-(4-cyanophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 131669-07-3) is a chemical compound with the molecular formula C18H16N2O4 and a molecular weight of 324.3 g/mol. IUPAC name: (2S)-3-(4-cyanophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: HNPWZDAPPQRAAF-INIZCTEOSA-N.
| Molecular formula | C18H16N2O4 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | (2S)-3-(4-cyanophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | HNPWZDAPPQRAAF-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)