Products 1316759-83-7
CAS 1316759-83-7 is the registry number for Ophiopogonanone B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, Get quote.
(3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one (CAS 1316759-83-7) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one. InChIKey: OOHKTNVQRTUZRS-GFCCVEGCSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one |
| InChIKey | OOHKTNVQRTUZRS-GFCCVEGCSA-N |
| SMILES | CC1=C(C2=C(C=C1O)OC[C@H](C2=O)CC3=CC=C(C=C3)OC)O |
Computed by PubChem (NCBI)