CAS 13168-00-8 is the registry number for Diphenhydramine N-Oxide Hydrochloride. Offered by: Mikromol, Biosynth. Available pack sizes: 25mg, 10mg.
2-benzhydryloxy-N,N-dimethylethanamine oxide;hydrochloride (CAS 13168-00-8) is a chemical compound with the molecular formula C17H22ClNO2 and a molecular weight of 307.8 g/mol. IUPAC name: 2-benzhydryloxy-N,N-dimethylethanamine oxide;hydrochloride. InChIKey: JWWPHMSWVFMLIF-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO2 |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | 2-benzhydryloxy-N,N-dimethylethanamine oxide;hydrochloride |
| InChIKey | JWWPHMSWVFMLIF-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCOC(C1=CC=CC=C1)C2=CC=CC=C2)[O-].Cl |
Computed by PubChem (NCBI)