Products 13168-00-8

CAS 13168-00-8 is the registry number for Diphenhydramine N-Oxide Hydrochloride. Offered by: Mikromol, Biosynth. Available pack sizes: 25mg, 10mg.

Structural formula: {0} (CAS {1})

2-benzhydryloxy-N,N-dimethylethanamine oxide;hydrochloride (CAS 13168-00-8) is a chemical compound with the molecular formula C17H22ClNO2 and a molecular weight of 307.8 g/mol. IUPAC name: 2-benzhydryloxy-N,N-dimethylethanamine oxide;hydrochloride. InChIKey: JWWPHMSWVFMLIF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22ClNO2
Molecular weight307.8 g/mol
IUPAC name2-benzhydryloxy-N,N-dimethylethanamine oxide;hydrochloride
InChIKeyJWWPHMSWVFMLIF-UHFFFAOYSA-N
SMILESC[N+](C)(CCOC(C1=CC=CC=C1)C2=CC=CC=C2)[O-].Cl

Computed by PubChem (NCBI)