Products 5978-81-4
CAS 5978-81-4 appears in our catalog under these names: Apoatropine HCl, Apoatropine Hydrochloride, >95% (HPLC), Atropine EP Impurity A (Hyoscyamine Sulfate Impurity G) as Hydrochloride, Apoatropine hydrochloride, Apoatropine hydrochloride. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 2,5g, 250mg, 25mg, 100mg, 10mg, 50mg, 500mg.
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylprop-2-enoate;hydrochloride (CAS 5978-81-4) is a chemical compound with the molecular formula C17H22ClNO2 and a molecular weight of 307.8 g/mol. IUPAC name: (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylprop-2-enoate;hydrochloride. InChIKey: RALAARQREFCZJO-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO2 |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylprop-2-enoate;hydrochloride |
| InChIKey | RALAARQREFCZJO-UHFFFAOYSA-N |
| SMILES | CN1C2CCC1CC(C2)OC(=O)C(=C)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)