CAS 251107-35-4 appears in our catalog under these names: tert-Butyl 4-(4-chlorobenzylidene)piperidine-1-carboxylate 95%, tert-Butyl 4-(4-chlorobenzylidene)piperidine-1-carboxylate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-[(4-chlorophenyl)methylidene]piperidine-1-carboxylate (CAS 251107-35-4) is a chemical compound with the molecular formula C17H22ClNO2 and a molecular weight of 307.8 g/mol. IUPAC name: tert-butyl 4-[(4-chlorophenyl)methylidene]piperidine-1-carboxylate. InChIKey: FEXIDQDEGTVERB-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO2 |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | tert-butyl 4-[(4-chlorophenyl)methylidene]piperidine-1-carboxylate |
| InChIKey | FEXIDQDEGTVERB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CC2=CC=C(C=C2)Cl)CC1 |
Computed by PubChem (NCBI)