CAS 335632-75-2 is the registry number for N-(Adamantan-1-yl)-2-chloro-N-(furan-2-ylmethyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(1-adamantyl)-2-chloro-N-(furan-2-ylmethyl)acetamide (CAS 335632-75-2) is a chemical compound with the molecular formula C17H22ClNO2 and a molecular weight of 307.8 g/mol. IUPAC name: N-(1-adamantyl)-2-chloro-N-(furan-2-ylmethyl)acetamide. InChIKey: DBBVGEGHVRNBQI-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO2 |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | N-(1-adamantyl)-2-chloro-N-(furan-2-ylmethyl)acetamide |
| InChIKey | DBBVGEGHVRNBQI-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)N(CC4=CC=CO4)C(=O)CCl |
Computed by PubChem (NCBI)