CAS 183182-07-2 appears in our catalog under these names: (R)–3–Amino–2–benzylpropanoic acid, (R)-3-Amino-2-benzylpropanoic acid, 98%, (R)-3-Amino-2-benzylpropanoic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-(aminomethyl)-3-phenylpropanoic acid (CAS 183182-07-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2R)-2-(aminomethyl)-3-phenylpropanoic acid. InChIKey: DJYVEBBGKNAHKE-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2R)-2-(aminomethyl)-3-phenylpropanoic acid |
| InChIKey | DJYVEBBGKNAHKE-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)