Products 131815-58-2
CAS 131815-58-2 is the registry number for N-(2-(4-Hydroxyphenyl)ethyl)acetamide-d3. Offered by: TRC. Available pack sizes: 100mg.
2,2,2-trideuterio-N-[2-(4-hydroxyphenyl)ethyl]acetamide (CAS 131815-58-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 182.23 g/mol. IUPAC name: 2,2,2-trideuterio-N-[2-(4-hydroxyphenyl)ethyl]acetamide. InChIKey: ATDWJOOPFDQZNK-FIBGUPNXSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 182.23 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
| InChIKey | ATDWJOOPFDQZNK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NCCC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)