CAS 131844-48-9 is the registry number for rac-(1R,2S)-2-(3-fluorophenyl)cyclopropan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1R,2S)-2-(3-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 131844-48-9) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: trans-(1R,2S)-2-(3-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: HZAULGOGPQNNCA-OULXEKPRSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | HZAULGOGPQNNCA-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)