CAS 1318769-38-8 is the registry number for ((2,3-Dichlorophenyl)methyl)hydrazine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,3-dichlorophenyl)methylhydrazine;hydrochloride (CAS 1318769-38-8) is a chemical compound with the molecular formula C7H9Cl3N2 and a molecular weight of 227.5 g/mol. IUPAC name: (2,3-dichlorophenyl)methylhydrazine;hydrochloride. InChIKey: GHJBXXOXBYYTAA-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl3N2 |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | (2,3-dichlorophenyl)methylhydrazine;hydrochloride |
| InChIKey | GHJBXXOXBYYTAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CNN.Cl |
Computed by PubChem (NCBI)