Products 1379462-58-4
CAS 1379462-58-4 appears in our catalog under these names: [(2,5-dichlorophenyl)methyl]hydrazine hydrochloride, 95%, ((2,5-Dichlorophenyl)methyl)hydrazine hydrochloride, 95%, ((2,5-Dichlorophenyl)methyl)hydrazine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(2,5-dichlorophenyl)methylhydrazine;hydrochloride (CAS 1379462-58-4) is a chemical compound with the molecular formula C7H9Cl3N2 and a molecular weight of 227.5 g/mol. IUPAC name: (2,5-dichlorophenyl)methylhydrazine;hydrochloride. InChIKey: AHPXPZLLTYZMDM-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl3N2 |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | (2,5-dichlorophenyl)methylhydrazine;hydrochloride |
| InChIKey | AHPXPZLLTYZMDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CNN)Cl.Cl |
Computed by PubChem (NCBI)