CAS 879645-40-6 appears in our catalog under these names: (2,4-Dichlorobenzyl)hydrazine hydrochloride, 95%, (2,4-Dichlorobenzyl)hydrazine hydrochloride, 97%, Hydrazine, [(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1), 98%, 98%, (2,4-dichlorobenzyl)hydrazine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
(2,4-dichlorophenyl)methylhydrazine;hydrochloride (CAS 879645-40-6) is a chemical compound with the molecular formula C7H9Cl3N2 and a molecular weight of 227.5 g/mol. IUPAC name: (2,4-dichlorophenyl)methylhydrazine;hydrochloride. InChIKey: CYFKAMFHYDGJRJ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl3N2 |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | (2,4-dichlorophenyl)methylhydrazine;hydrochloride |
| InChIKey | CYFKAMFHYDGJRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CNN.Cl |
Computed by PubChem (NCBI)