Products 91467-53-7

CAS 91467-53-7 appears in our catalog under these names: (3,4-Dichlorobenzyl)hydrazine dihydrochloride, 95%, (3,4-Dichlorobenzyl)hydrazine hydrochloride, 97%, 97%, (3,4-dichlorobenzyl)hydrazine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 100mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

(3,4-dichlorophenyl)methylhydrazine;hydrochloride (CAS 91467-53-7) is a chemical compound with the molecular formula C7H9Cl3N2 and a molecular weight of 227.5 g/mol. IUPAC name: (3,4-dichlorophenyl)methylhydrazine;hydrochloride. InChIKey: ZVGOHPRQTOMWPE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9Cl3N2
Molecular weight227.5 g/mol
IUPAC name(3,4-dichlorophenyl)methylhydrazine;hydrochloride
InChIKeyZVGOHPRQTOMWPE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CNN)Cl)Cl.Cl

Computed by PubChem (NCBI)