CAS 131906-15-5 appears in our catalog under these names: 4-Cyano-3-phenylbutanoic acid, 95%, 4-Cyano-3-phenylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-cyano-3-phenylbutanoic acid (CAS 131906-15-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 4-cyano-3-phenylbutanoic acid. InChIKey: MZGSUTHFZYOIHU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4-cyano-3-phenylbutanoic acid |
| InChIKey | MZGSUTHFZYOIHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC#N)CC(=O)O |
Computed by PubChem (NCBI)