Products 131922-28-6
CAS 131922-28-6 is the registry number for D4-Ribavirin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,2,4-triazole-3-carboxamide (CAS 131922-28-6) is a chemical compound with the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. IUPAC name: 1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,2,4-triazole-3-carboxamide. InChIKey: RAQSTELPKQLBOP-NTSWFWBYSA-N.
| Molecular formula | C8H10N4O3 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1,2,4-triazole-3-carboxamide |
| InChIKey | RAQSTELPKQLBOP-NTSWFWBYSA-N |
| SMILES | C1=C[C@@H](O[C@@H]1CO)N2C=NC(=N2)C(=O)N |
Computed by PubChem (NCBI)