CAS 131974-73-7 is the registry number for Cyproconazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-4-yl)butan-2-ol (CAS 131974-73-7) is a chemical compound with the molecular formula C15H18ClN3O and a molecular weight of 291.77 g/mol. IUPAC name: 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-4-yl)butan-2-ol. InChIKey: KQIUGDCMFJTWIC-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3O |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3-cyclopropyl-1-(1,2,4-triazol-4-yl)butan-2-ol |
| InChIKey | KQIUGDCMFJTWIC-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)C(CN2C=NN=C2)(C3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)