CAS 63190-87-4 is the registry number for Paclobutrazol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-one (CAS 63190-87-4) is a chemical compound with the molecular formula C15H18ClN3O and a molecular weight of 291.77 g/mol. IUPAC name: 1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-one. InChIKey: SPYIJNRBRKUDJS-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3O |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-one |
| InChIKey | SPYIJNRBRKUDJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(CC1=CC=C(C=C1)Cl)N2C=NC=N2 |
Computed by PubChem (NCBI)