CAS 2140327-52-0 is the registry number for Cycloprocanazole-d3. Offered by: TRC. Available pack sizes: 100mg.
2-(4-chlorophenyl)-3-cyclopropyl-4,4,4-trideuterio-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 2140327-52-0) is a chemical compound with the molecular formula C15H18ClN3O and a molecular weight of 294.79 g/mol. IUPAC name: 2-(4-chlorophenyl)-3-cyclopropyl-4,4,4-trideuterio-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: UFNOUKDBUJZYDE-FIBGUPNXSA-N.
| Molecular formula | C15H18ClN3O |
|---|---|
| Molecular weight | 294.79 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3-cyclopropyl-4,4,4-trideuterio-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | UFNOUKDBUJZYDE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1CC1)C(CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)