Products 849140-31-4
CAS 849140-31-4 is the registry number for 7-Chloro-2-((4-methylpiperidin-1-yl)methyl)quinazolin-4(3H)-one, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
7-chloro-2-[(4-methylpiperidin-1-yl)methyl]-3H-quinazolin-4-one (CAS 849140-31-4) is a chemical compound with the molecular formula C15H18ClN3O and a molecular weight of 291.77 g/mol. IUPAC name: 7-chloro-2-[(4-methylpiperidin-1-yl)methyl]-3H-quinazolin-4-one. InChIKey: NHTAQXURKZZSJV-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3O |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | 7-chloro-2-[(4-methylpiperidin-1-yl)methyl]-3H-quinazolin-4-one |
| InChIKey | NHTAQXURKZZSJV-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)CC2=NC3=C(C=CC(=C3)Cl)C(=O)N2 |
Computed by PubChem (NCBI)