Products 132-21-8
CAS 132-21-8 appears in our catalog under these names: Dexbrompheniramine, Dexbrompheniramine, 99.60%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 10 mg.
(3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine (CAS 132-21-8) is a chemical compound with the molecular formula C16H19BrN2 and a molecular weight of 319.24 g/mol. IUPAC name: (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine. InChIKey: ZDIGNSYAACHWNL-HNNXBMFYSA-N.
| Molecular formula | C16H19BrN2 |
|---|---|
| Molecular weight | 319.24 g/mol |
| IUPAC name | (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| InChIKey | ZDIGNSYAACHWNL-HNNXBMFYSA-N |
| SMILES | CN(C)CC[C@@H](C1=CC=C(C=C1)Br)C2=CC=CC=N2 |
Computed by PubChem (NCBI)