Products 32656-44-3
CAS 32656-44-3 is the registry number for (-)-Brompheniramine, 99.67%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 50 mg, 100 mg, 10 mg.
(3R)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine (CAS 32656-44-3) is a chemical compound with the molecular formula C16H19BrN2 and a molecular weight of 319.24 g/mol. IUPAC name: (3R)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine. InChIKey: ZDIGNSYAACHWNL-OAHLLOKOSA-N.
| Molecular formula | C16H19BrN2 |
|---|---|
| Molecular weight | 319.24 g/mol |
| IUPAC name | (3R)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| InChIKey | ZDIGNSYAACHWNL-OAHLLOKOSA-N |
| SMILES | CN(C)CC[C@H](C1=CC=C(C=C1)Br)C2=CC=CC=N2 |
Computed by PubChem (NCBI)