Products 67411-41-0
CAS 67411-41-0 appears in our catalog under these names: Antidepressant agent 1, Antidepressant agent 1, Antidepressant agent 1, 98.84%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 10mM (in 1ml dmso), 50mg, 100 mg, 10mM/1mL, 10 mg.
12-bromo-4-ethyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (CAS 67411-41-0) is a chemical compound with the molecular formula C16H19BrN2 and a molecular weight of 319.24 g/mol. IUPAC name: 12-bromo-4-ethyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene. InChIKey: VRTKXFMWBVSAET-UHFFFAOYSA-N.
| Molecular formula | C16H19BrN2 |
|---|---|
| Molecular weight | 319.24 g/mol |
| IUPAC name | 12-bromo-4-ethyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| InChIKey | VRTKXFMWBVSAET-UHFFFAOYSA-N |
| SMILES | CCN1CCN2C3=C(C=C(C=C3)Br)C4=C2C1CCC4 |
Computed by PubChem (NCBI)