CAS 132036-39-6 is the registry number for 5-((1-Methylindole-3-yl)carbonyl)-4,5,6,7-tetrahydro-1H-bezimidazole. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 1g, 2g, 5g.
(1-methylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone (CAS 132036-39-6) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: (1-methylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone. InChIKey: NTHPAPBPFQJABD-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | (1-methylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone |
| InChIKey | NTHPAPBPFQJABD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C3CCC4=C(C3)NC=N4 |
Computed by PubChem (NCBI)