CAS 132036-90-9 is the registry number for (S)-Ramosetron. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(1-methylindol-3-yl)-[(5S)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone (CAS 132036-90-9) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: (1-methylindol-3-yl)-[(5S)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone. InChIKey: NTHPAPBPFQJABD-NSHDSACASA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | (1-methylindol-3-yl)-[(5S)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone |
| InChIKey | NTHPAPBPFQJABD-NSHDSACASA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)[C@H]3CCC4=C(C3)NC=N4 |
Computed by PubChem (NCBI)