Products 132066-28-5
CAS 132066-28-5 is the registry number for Methyl 5-amino-3-(3-chlorophenyl)isoxazole-4-carboxylate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-amino-3-(3-chlorophenyl)-1,2-oxazole-4-carboxylate (CAS 132066-28-5) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: methyl 5-amino-3-(3-chlorophenyl)-1,2-oxazole-4-carboxylate. InChIKey: LYNXKQGGZWGCEI-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 5-amino-3-(3-chlorophenyl)-1,2-oxazole-4-carboxylate |
| InChIKey | LYNXKQGGZWGCEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(ON=C1C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)