CAS 13207-66-4 appears in our catalog under these names: 5-Aminoquinolin-8-ol, 96%, 5-Amino-8-hydroxyquinoline, 5–Amino–8–hydroxyquinoline, 5-Amino-8-hydroxyquinoline 95%, 5-Aminoquinolin-8-ol, 95%, 95%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g, 10g, 25g, 250 mg.
5-aminoquinolin-8-ol (CAS 13207-66-4) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-aminoquinolin-8-ol. InChIKey: YDEUKNRKEYICTH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-aminoquinolin-8-ol |
| InChIKey | YDEUKNRKEYICTH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)N |
Computed by PubChem (NCBI)