CAS 132074-01-2 is the registry number for Methyl(2R,3S)-N-Benzoyl-3-Phenylisoserine, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Methyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate (CAS 132074-01-2) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: methyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate. InChIKey: UYJLJICUXJPKTB-LSDHHAIUSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | methyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
| InChIKey | UYJLJICUXJPKTB-LSDHHAIUSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)